C35H46FN3O4 — CID 14029125
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-fluorophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide (PubChem CID 14029125) has the molecular formula C35H46FN3O4 and a molecular weight of 591.77 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-fluorophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-fluorophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide |
|---|---|
| PubChem CID | 14029125 |
| Molecular Formula | C35H46FN3O4 |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-fluorophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide |
| SMILES | CCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(NC(=O)Nc2ccc(F)cc2)c(O)c1 |
| InChI | InChI=1S/C35H46FN3O4/c1-8-11-12-31(43-30-20-13-23(34(4,5)9-2)21-27(30)35(6,7)10-3)32(41)37-26-18-19-28(29(40)22-26)39-33(42)38-25-16-14-24(36)15-17-25/h13-22,31,40H,8-12H2,1-7H3,(H,37,41)(H2,38,39,42) |
| InChIKey | UXKZLSZUMYOIIR-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|