C30H43FN2O4 — CID 101292228
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(2-fluorobutanoylamino)-3-hydroxyphenyl]butanamide (PubChem CID 101292228) has the molecular formula C30H43FN2O4 and a molecular weight of 514.68 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(2-fluorobutanoylamino)-3-hydroxyphenyl]butanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(2-fluorobutanoylamino)-3-hydroxyphenyl]butanamide |
|---|---|
| PubChem CID | 101292228 |
| Molecular Formula | C30H43FN2O4 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(2-fluorobutanoylamino)-3-hydroxyphenyl]butanamide |
| SMILES | CCC(F)C(=O)Nc1ccc(NC(=O)C(CC)Oc2ccc(C(C)(C)CC)cc2C(C)(C)CC)cc1O |
| InChI | InChI=1S/C30H43FN2O4/c1-9-22(31)27(35)33-23-15-14-20(18-24(23)34)32-28(36)25(10-2)37-26-16-13-19(29(5,6)11-3)17-21(26)30(7,8)12-4/h13-18,22,25,34H,9-12H2,1-8H3,(H,32,36)(H,33,35) |
| InChIKey | BIMZSBUQVNVVQC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|