C39H46Cl2F6N2O6 — CID 20530645
N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoylamino]-2-hydroxyphenyl]-2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzamide (PubChem CID 20530645) has the molecular formula C39H46Cl2F6N2O6 and a molecular weight of 823.70 g/mol. Its IUPAC name is N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoylamino]-2-hydroxyphenyl]-2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzamide.
| Compound Name | N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoylamino]-2-hydroxyphenyl]-2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 20530645 |
| Molecular Formula | C39H46Cl2F6N2O6 |
| Molecular Weight | 823.70 g/mol |
| Exact Mass | 822.26 |
| IUPAC Name | N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoylamino]-2-hydroxyphenyl]-2,4-bis(2-chloro-1,1,2-trifluoroethoxy)benzamide |
| SMILES | CCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(NC(=O)c2ccc(OC(F)(F)C(F)Cl)cc2OC(F)(F)C(F)Cl)c(O)c1 |
| InChI | InChI=1S/C39H46Cl2F6N2O6/c1-8-11-12-30(53-29-18-13-22(36(4,5)9-2)19-26(29)37(6,7)10-3)33(52)48-23-14-17-27(28(50)20-23)49-32(51)25-16-15-24(54-38(44,45)34(40)42)21-31(25)55-39(46,47)35(41)43/h13-21,30,34-35,50H,8-12H2,1-7H3,(H,48,52)(H,49,51) |
| InChIKey | HGSPPMSSMSPCFP-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.70 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|