C30H39F7N2O3 — CID 88713806
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(1,1,2,2,3,3,4-heptafluorobutylamino)-3-hydroxyphenyl]butanamide (PubChem CID 88713806) has the molecular formula C30H39F7N2O3 and a molecular weight of 608.64 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(1,1,2,2,3,3,4-heptafluorobutylamino)-3-hydroxyphenyl]butanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(1,1,2,2,3,3,4-heptafluorobutylamino)-3-hydroxyphenyl]butanamide |
|---|---|
| PubChem CID | 88713806 |
| Molecular Formula | C30H39F7N2O3 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-(1,1,2,2,3,3,4-heptafluorobutylamino)-3-hydroxyphenyl]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(NC(F)(F)C(F)(F)C(F)(F)CF)c(O)c1 |
| InChI | InChI=1S/C30H39F7N2O3/c1-8-23(42-24-14-11-18(26(4,5)9-2)15-20(24)27(6,7)10-3)25(41)38-19-12-13-21(22(40)16-19)39-30(36,37)29(34,35)28(32,33)17-31/h11-16,23,39-40H,8-10,17H2,1-7H3,(H,38,41) |
| InChIKey | OOSBLTQAZIZPQB-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|