C36H46N4O4 — CID 3342010
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(3-cyanophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide (PubChem CID 3342010) has the molecular formula C36H46N4O4 and a molecular weight of 598.79 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(3-cyanophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(3-cyanophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide |
|---|---|
| PubChem CID | 3342010 |
| Molecular Formula | C36H46N4O4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(3-cyanophenyl)carbamoylamino]-3-hydroxyphenyl]hexanamide |
| SMILES | CCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(NC(=O)Nc2cccc(C#N)c2)c(O)c1 |
| InChI | InChI=1S/C36H46N4O4/c1-8-11-15-32(44-31-19-16-25(35(4,5)9-2)21-28(31)36(6,7)10-3)33(42)38-27-17-18-29(30(41)22-27)40-34(43)39-26-14-12-13-24(20-26)23-37/h12-14,16-22,32,41H,8-11,15H2,1-7H3,(H,38,42)(H2,39,40,43) |
| InChIKey | WFZMHTNXSRJPOE-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|