C44H54N4O5 — CID 22955856
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-cyanophenyl)carbamoylamino]-2-(4-ethylphenoxy)-5-hydroxyphenyl]hexanamide (PubChem CID 22955856) has the molecular formula C44H54N4O5 and a molecular weight of 718.94 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-cyanophenyl)carbamoylamino]-2-(4-ethylphenoxy)-5-hydroxyphenyl]hexanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-cyanophenyl)carbamoylamino]-2-(4-ethylphenoxy)-5-hydroxyphenyl]hexanamide |
|---|---|
| PubChem CID | 22955856 |
| Molecular Formula | C44H54N4O5 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.41 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[(4-cyanophenyl)carbamoylamino]-2-(4-ethylphenoxy)-5-hydroxyphenyl]hexanamide |
| SMILES | CCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cc(O)c(NC(=O)Nc2ccc(C#N)cc2)cc1Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C44H54N4O5/c1-9-13-14-39(53-38-24-19-31(43(5,6)11-3)25-34(38)44(7,8)12-4)41(50)47-36-26-37(49)35(27-40(36)52-33-22-17-29(10-2)18-23-33)48-42(51)46-32-20-15-30(28-45)16-21-32/h15-27,39,49H,9-14H2,1-8H3,(H,47,50)(H2,46,48,51) |
| InChIKey | MFBDORJZOBCTDP-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|