C32H30N4O6 — CID 58587415
N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methoxyphenoxy)phenyl]-2-(2,4-dimethylphenoxy)propanamide (PubChem CID 58587415) has the molecular formula C32H30N4O6 and a molecular weight of 566.61 g/mol. Its IUPAC name is N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methoxyphenoxy)phenyl]-2-(2,4-dimethylphenoxy)propanamide.
| Compound Name | N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methoxyphenoxy)phenyl]-2-(2,4-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 58587415 |
| Molecular Formula | C32H30N4O6 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methoxyphenoxy)phenyl]-2-(2,4-dimethylphenoxy)propanamide |
| SMILES | COc1ccc(Oc2cc(NC(=O)Nc3ccc(C#N)cc3)c(O)cc2NC(=O)C(C)Oc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C32H30N4O6/c1-19-5-14-29(20(2)15-19)41-21(3)31(38)35-27-16-28(37)26(17-30(27)42-25-12-10-24(40-4)11-13-25)36-32(39)34-23-8-6-22(18-33)7-9-23/h5-17,21,37H,1-4H3,(H,35,38)(H2,34,36,39) |
| InChIKey | QNTBJOZGAIBCJG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|