C37H40N4O5 — CID 22085894
N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methylphenoxy)phenyl]-2-(2,4-dimethylphenoxy)octanamide (PubChem CID 22085894) has the molecular formula C37H40N4O5 and a molecular weight of 620.75 g/mol. Its IUPAC name is N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methylphenoxy)phenyl]-2-(2,4-dimethylphenoxy)octanamide.
| Compound Name | N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methylphenoxy)phenyl]-2-(2,4-dimethylphenoxy)octanamide |
|---|---|
| PubChem CID | 22085894 |
| Molecular Formula | C37H40N4O5 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | N-[4-[(4-cyanophenyl)carbamoylamino]-5-hydroxy-2-(4-methylphenoxy)phenyl]-2-(2,4-dimethylphenoxy)octanamide |
| SMILES | CCCCCCC(Oc1ccc(C)cc1C)C(=O)Nc1cc(O)c(NC(=O)Nc2ccc(C#N)cc2)cc1Oc1ccc(C)cc1 |
| InChI | InChI=1S/C37H40N4O5/c1-5-6-7-8-9-34(46-33-19-12-25(3)20-26(33)4)36(43)40-31-21-32(42)30(22-35(31)45-29-17-10-24(2)11-18-29)41-37(44)39-28-15-13-27(23-38)14-16-28/h10-22,34,42H,5-9H2,1-4H3,(H,40,43)(H2,39,41,44) |
| InChIKey | SELYTBSJWLLXRR-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|