C20H33NO2 — CID 54249044
2-(2,4-dimethylphenoxy)-N-(2-methylpropyl)octanamide (PubChem CID 54249044) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-(2-methylpropyl)octanamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-(2-methylpropyl)octanamide |
|---|---|
| PubChem CID | 54249044 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-(2-methylpropyl)octanamide |
| SMILES | CCCCCCC(Oc1ccc(C)cc1C)C(=O)NCC(C)C |
| InChI | InChI=1S/C20H33NO2/c1-6-7-8-9-10-19(20(22)21-14-15(2)3)23-18-12-11-16(4)13-17(18)5/h11-13,15,19H,6-10,14H2,1-5H3,(H,21,22) |
| InChIKey | QVKWVIDEIFNZMF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|