C20H25NO2 — CID 14211244
2-(2,4-dimethylphenoxy)-N-[(2-methylphenyl)methyl]butanamide (PubChem CID 14211244) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[(2-methylphenyl)methyl]butanamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[(2-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 14211244 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[(2-methylphenyl)methyl]butanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)NCc1ccccc1C |
| InChI | InChI=1S/C20H25NO2/c1-5-18(23-19-11-10-14(2)12-16(19)4)20(22)21-13-17-9-7-6-8-15(17)3/h6-12,18H,5,13H2,1-4H3,(H,21,22) |
| InChIKey | OYMIVMCWXJCVQP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |