C21H26FNO2S — CID 132656452
2-(2,4-dimethylphenoxy)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]butanamide (PubChem CID 132656452) has the molecular formula C21H26FNO2S and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]butanamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 132656452 |
| Molecular Formula | C21H26FNO2S |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]butanamide |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)NCCSCc1ccccc1F |
| InChI | InChI=1S/C21H26FNO2S/c1-4-19(25-20-10-9-15(2)13-16(20)3)21(24)23-11-12-26-14-17-7-5-6-8-18(17)22/h5-10,13,19H,4,11-12,14H2,1-3H3,(H,23,24) |
| InChIKey | XEZSKPXGCUFWIN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|