C23H28FNO2S — CID 133178633
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 133178633) has the molecular formula C23H28FNO2S and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 133178633 |
| Molecular Formula | C23H28FNO2S |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)CCCC2)C(=O)NCCSCc1ccccc1F |
| InChI | InChI=1S/C23H28FNO2S/c1-2-22(27-20-12-11-17-7-3-4-8-18(17)15-20)23(26)25-13-14-28-16-19-9-5-6-10-21(19)24/h5-6,9-12,15,22H,2-4,7-8,13-14,16H2,1H3,(H,25,26) |
| InChIKey | AJKWUJVLNDIVAE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|