C19H25NO3S — CID 92683250
(2R)-2-(2,5-dimethylphenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide (PubChem CID 92683250) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is (2R)-2-(2,5-dimethylphenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide.
| Compound Name | (2R)-2-(2,5-dimethylphenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide |
|---|---|
| PubChem CID | 92683250 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2R)-2-(2,5-dimethylphenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide |
| SMILES | CC[C@@H](Oc1cc(C)ccc1C)C(=O)NCCSCc1ccco1 |
| InChI | InChI=1S/C19H25NO3S/c1-4-17(23-18-12-14(2)7-8-15(18)3)19(21)20-9-11-24-13-16-6-5-10-22-16/h5-8,10,12,17H,4,9,11,13H2,1-3H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | LIBGUHLISKFDBX-QGZVFWFLSA-N |
| XLogP | 4.10 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|