C17H20ClNO3S — CID 43909378
2-(2-chlorophenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide (PubChem CID 43909378) has the molecular formula C17H20ClNO3S and a molecular weight of 353.87 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide |
|---|---|
| PubChem CID | 43909378 |
| Molecular Formula | C17H20ClNO3S |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]butanamide |
| SMILES | CCC(Oc1ccccc1Cl)C(=O)NCCSCc1ccco1 |
| InChI | InChI=1S/C17H20ClNO3S/c1-2-15(22-16-8-4-3-7-14(16)18)17(20)19-9-11-23-12-13-6-5-10-21-13/h3-8,10,15H,2,9,11-12H2,1H3,(H,19,20) |
| InChIKey | VUKRKTAOMKNCRA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|