C19H22FNO2S — CID 94012917
(2R)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(2-methylphenoxy)propanamide (PubChem CID 94012917) has the molecular formula C19H22FNO2S and a molecular weight of 347.45 g/mol. Its IUPAC name is (2R)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(2-methylphenoxy)propanamide.
| Compound Name | (2R)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 94012917 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (2R)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(2-methylphenoxy)propanamide |
| SMILES | Cc1ccccc1O[C@H](C)C(=O)NCCSCc1ccccc1F |
| InChI | InChI=1S/C19H22FNO2S/c1-14-7-3-6-10-18(14)23-15(2)19(22)21-11-12-24-13-16-8-4-5-9-17(16)20/h3-10,15H,11-13H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | JMQXUSCPOVVZGF-OAHLLOKOSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|