C29H31N3O5 — CID 59941810
(4-cyanophenyl) N-[4-[2-(2,4-dimethylphenoxy)hexanoylamino]-3-hydroxyphenyl]-N-methylcarbamate (PubChem CID 59941810) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is (4-cyanophenyl) N-[4-[2-(2,4-dimethylphenoxy)hexanoylamino]-3-hydroxyphenyl]-N-methylcarbamate.
| Compound Name | (4-cyanophenyl) N-[4-[2-(2,4-dimethylphenoxy)hexanoylamino]-3-hydroxyphenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59941810 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (4-cyanophenyl) N-[4-[2-(2,4-dimethylphenoxy)hexanoylamino]-3-hydroxyphenyl]-N-methylcarbamate |
| SMILES | CCCCC(Oc1ccc(C)cc1C)C(=O)Nc1ccc(N(C)C(=O)Oc2ccc(C#N)cc2)cc1O |
| InChI | InChI=1S/C29H31N3O5/c1-5-6-7-27(37-26-15-8-19(2)16-20(26)3)28(34)31-24-14-11-22(17-25(24)33)32(4)29(35)36-23-12-9-21(18-30)10-13-23/h8-17,27,33H,5-7H2,1-4H3,(H,31,34) |
| InChIKey | HXVJPMGFAQAPDC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|