C29H32Cl2N2O5 — CID 22964918
(4-tert-butylphenyl) N-[5-chloro-4-[2-(2-chlorophenoxy)hexanoylamino]-2-hydroxyphenyl]carbamate (PubChem CID 22964918) has the molecular formula C29H32Cl2N2O5 and a molecular weight of 559.49 g/mol. Its IUPAC name is (4-tert-butylphenyl) N-[5-chloro-4-[2-(2-chlorophenoxy)hexanoylamino]-2-hydroxyphenyl]carbamate.
| Compound Name | (4-tert-butylphenyl) N-[5-chloro-4-[2-(2-chlorophenoxy)hexanoylamino]-2-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 22964918 |
| Molecular Formula | C29H32Cl2N2O5 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | (4-tert-butylphenyl) N-[5-chloro-4-[2-(2-chlorophenoxy)hexanoylamino]-2-hydroxyphenyl]carbamate |
| SMILES | CCCCC(Oc1ccccc1Cl)C(=O)Nc1cc(O)c(NC(=O)Oc2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C29H32Cl2N2O5/c1-5-6-10-26(38-25-11-8-7-9-20(25)30)27(35)32-22-17-24(34)23(16-21(22)31)33-28(36)37-19-14-12-18(13-15-19)29(2,3)4/h7-9,11-17,26,34H,5-6,10H2,1-4H3,(H,32,35)(H,33,36) |
| InChIKey | SGDYDKWYICKBOU-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|