C21H24ClN3O3 — CID 22967826
N-[2-chloro-4-[(4-cyanophenoxy)methylamino]-5-hydroxyphenyl]-2-methylhexanamide (PubChem CID 22967826) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-[2-chloro-4-[(4-cyanophenoxy)methylamino]-5-hydroxyphenyl]-2-methylhexanamide.
| Compound Name | N-[2-chloro-4-[(4-cyanophenoxy)methylamino]-5-hydroxyphenyl]-2-methylhexanamide |
|---|---|
| PubChem CID | 22967826 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[2-chloro-4-[(4-cyanophenoxy)methylamino]-5-hydroxyphenyl]-2-methylhexanamide |
| SMILES | CCCCC(C)C(=O)Nc1cc(O)c(NCOc2ccc(C#N)cc2)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O3/c1-3-4-5-14(2)21(27)25-18-11-20(26)19(10-17(18)22)24-13-28-16-8-6-15(12-23)7-9-16/h6-11,14,24,26H,3-5,13H2,1-2H3,(H,25,27) |
| InChIKey | MJABMSMERDLVAD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|