C21H23ClN4O5S — CID 71158602
N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylsulfonylhexanamide (PubChem CID 71158602) has the molecular formula C21H23ClN4O5S and a molecular weight of 478.96 g/mol. Its IUPAC name is N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylsulfonylhexanamide.
| Compound Name | N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylsulfonylhexanamide |
|---|---|
| PubChem CID | 71158602 |
| Molecular Formula | C21H23ClN4O5S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[2-chloro-4-[(4-cyanophenyl)carbamoylamino]-5-hydroxyphenyl]-2-methylsulfonylhexanamide |
| SMILES | CCCCC(C(=O)Nc1cc(O)c(NC(=O)Nc2ccc(C#N)cc2)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C21H23ClN4O5S/c1-3-4-5-19(32(2,30)31)20(28)25-16-11-18(27)17(10-15(16)22)26-21(29)24-14-8-6-13(12-23)7-9-14/h6-11,19,27H,3-5H2,1-2H3,(H,25,28)(H2,24,26,29) |
| InChIKey | SOWVSXIPSTUSIP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|