C25H22ClN3O5S — CID 22964937
N-[5-chloro-2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]phenyl]-4-cyanobenzamide (PubChem CID 22964937) has the molecular formula C25H22ClN3O5S and a molecular weight of 511.99 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]phenyl]-4-cyanobenzamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]phenyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 22964937 |
| Molecular Formula | C25H22ClN3O5S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[2-(4-methylphenyl)sulfonylbutanoylamino]phenyl]-4-cyanobenzamide |
| SMILES | CCC(C(=O)Nc1cc(O)c(NC(=O)c2ccc(C#N)cc2)cc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H22ClN3O5S/c1-3-23(35(33,34)18-10-4-15(2)5-11-18)25(32)28-20-13-22(30)21(12-19(20)26)29-24(31)17-8-6-16(14-27)7-9-17/h4-13,23,30H,3H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | YODPJKGYDQMLQU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|