C24H22Cl2N2O5S — CID 59950451
N-[4-[2-(benzenesulfonyl)butanoylamino]-5-chloro-2-hydroxyphenyl]-2-chloro-4-methylbenzamide (PubChem CID 59950451) has the molecular formula C24H22Cl2N2O5S and a molecular weight of 521.42 g/mol. Its IUPAC name is N-[4-[2-(benzenesulfonyl)butanoylamino]-5-chloro-2-hydroxyphenyl]-2-chloro-4-methylbenzamide.
| Compound Name | N-[4-[2-(benzenesulfonyl)butanoylamino]-5-chloro-2-hydroxyphenyl]-2-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 59950451 |
| Molecular Formula | C24H22Cl2N2O5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | N-[4-[2-(benzenesulfonyl)butanoylamino]-5-chloro-2-hydroxyphenyl]-2-chloro-4-methylbenzamide |
| SMILES | CCC(C(=O)Nc1cc(O)c(NC(=O)c2ccc(C)cc2Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22Cl2N2O5S/c1-3-22(34(32,33)15-7-5-4-6-8-15)24(31)27-19-13-21(29)20(12-18(19)26)28-23(30)16-10-9-14(2)11-17(16)25/h4-13,22,29H,3H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | BLKXALWTVGPQMB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|