C21H23ClN2O5S — CID 20618135
N-[2-chloro-5-hydroxy-4-(2-methylprop-2-enoylamino)phenyl]-2-(4-methylphenyl)sulfonylbutanamide (PubChem CID 20618135) has the molecular formula C21H23ClN2O5S and a molecular weight of 450.94 g/mol. Its IUPAC name is N-[2-chloro-5-hydroxy-4-(2-methylprop-2-enoylamino)phenyl]-2-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | N-[2-chloro-5-hydroxy-4-(2-methylprop-2-enoylamino)phenyl]-2-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 20618135 |
| Molecular Formula | C21H23ClN2O5S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[2-chloro-5-hydroxy-4-(2-methylprop-2-enoylamino)phenyl]-2-(4-methylphenyl)sulfonylbutanamide |
| SMILES | C=C(C)C(=O)Nc1cc(Cl)c(NC(=O)C(CC)S(=O)(=O)c2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C21H23ClN2O5S/c1-5-19(30(28,29)14-8-6-13(4)7-9-14)21(27)23-16-11-18(25)17(10-15(16)22)24-20(26)12(2)3/h6-11,19,25H,2,5H2,1,3-4H3,(H,23,27)(H,24,26) |
| InChIKey | AZQKZBZMGSDSOE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|