C23H20Cl3N3O5S — CID 18740299
2,6-dichloro-N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]pyridine-3-carboxamide (PubChem CID 18740299) has the molecular formula C23H20Cl3N3O5S and a molecular weight of 556.86 g/mol. Its IUPAC name is 2,6-dichloro-N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18740299 |
| Molecular Formula | C23H20Cl3N3O5S |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | 2,6-dichloro-N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]pyridine-3-carboxamide |
| SMILES | CCC(C(=O)Nc1cc(O)c(NC(=O)c2ccc(Cl)nc2Cl)cc1Cl)S(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C23H20Cl3N3O5S/c1-3-19(35(33,34)13-6-4-5-12(2)9-13)23(32)27-16-11-18(30)17(10-15(16)24)28-22(31)14-7-8-20(25)29-21(14)26/h4-11,19,30H,3H2,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | PKCGGZIWPOJDFC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|