C27H29ClN2O6S — CID 20665617
N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-phenoxybutanamide (PubChem CID 20665617) has the molecular formula C27H29ClN2O6S and a molecular weight of 545.06 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-phenoxybutanamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-phenoxybutanamide |
|---|---|
| PubChem CID | 20665617 |
| Molecular Formula | C27H29ClN2O6S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-phenoxybutanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)Nc1cc(Cl)c(NC(=O)C(CC)S(=O)(=O)c2cccc(C)c2)cc1O |
| InChI | InChI=1S/C27H29ClN2O6S/c1-4-24(36-18-11-7-6-8-12-18)26(32)30-22-15-20(28)21(16-23(22)31)29-27(33)25(5-2)37(34,35)19-13-9-10-17(3)14-19/h6-16,24-25,31H,4-5H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | AVZIJYPZNVGVNK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|