C24H23ClN2O6S — CID 59950442
N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-hydroxybenzamide (PubChem CID 59950442) has the molecular formula C24H23ClN2O6S and a molecular weight of 502.98 g/mol. Its IUPAC name is N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-hydroxybenzamide.
| Compound Name | N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 59950442 |
| Molecular Formula | C24H23ClN2O6S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N-[5-chloro-2-hydroxy-4-[2-(3-methylphenyl)sulfonylbutanoylamino]phenyl]-2-hydroxybenzamide |
| SMILES | CCC(C(=O)Nc1cc(O)c(NC(=O)c2ccccc2O)cc1Cl)S(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C24H23ClN2O6S/c1-3-22(34(32,33)15-8-6-7-14(2)11-15)24(31)26-18-13-21(29)19(12-17(18)25)27-23(30)16-9-4-5-10-20(16)28/h4-13,22,28-29H,3H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | JPAXJPOYIKDXGK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|