C19H20Cl2N4O5S — CID 59062155
N-[2-chloro-4-(2-hydrazinylidenepropanoylamino)-5-hydroxyphenyl]-2-(4-chlorophenyl)sulfonylbutanamide (PubChem CID 59062155) has the molecular formula C19H20Cl2N4O5S and a molecular weight of 487.37 g/mol. Its IUPAC name is N-[2-chloro-4-(2-hydrazinylidenepropanoylamino)-5-hydroxyphenyl]-2-(4-chlorophenyl)sulfonylbutanamide.
| Compound Name | N-[2-chloro-4-(2-hydrazinylidenepropanoylamino)-5-hydroxyphenyl]-2-(4-chlorophenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 59062155 |
| Molecular Formula | C19H20Cl2N4O5S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-[2-chloro-4-(2-hydrazinylidenepropanoylamino)-5-hydroxyphenyl]-2-(4-chlorophenyl)sulfonylbutanamide |
| SMILES | CCC(C(=O)Nc1cc(O)c(NC(=O)C(C)=NN)cc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2N4O5S/c1-3-17(31(29,30)12-6-4-11(20)5-7-12)19(28)23-14-9-16(26)15(8-13(14)21)24-18(27)10(2)25-22/h4-9,17,26H,3,22H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | ZNAYXJOLBHKGGX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|