C29H31ClN2O7S2 — CID 20742621
butan-2-yl 4-[[5-chloro-2-hydroxy-4-[2-(4-methylsulfanylphenyl)sulfonylbutanoylamino]phenyl]carbamoyl]benzoate (PubChem CID 20742621) has the molecular formula C29H31ClN2O7S2 and a molecular weight of 619.16 g/mol. Its IUPAC name is butan-2-yl 4-[[5-chloro-2-hydroxy-4-[2-(4-methylsulfanylphenyl)sulfonylbutanoylamino]phenyl]carbamoyl]benzoate.
| Compound Name | butan-2-yl 4-[[5-chloro-2-hydroxy-4-[2-(4-methylsulfanylphenyl)sulfonylbutanoylamino]phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 20742621 |
| Molecular Formula | C29H31ClN2O7S2 |
| Molecular Weight | 619.16 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | butan-2-yl 4-[[5-chloro-2-hydroxy-4-[2-(4-methylsulfanylphenyl)sulfonylbutanoylamino]phenyl]carbamoyl]benzoate |
| SMILES | CCC(C)OC(=O)c1ccc(C(=O)Nc2cc(Cl)c(NC(=O)C(CC)S(=O)(=O)c3ccc(SC)cc3)cc2O)cc1 |
| InChI | InChI=1S/C29H31ClN2O7S2/c1-5-17(3)39-29(36)19-9-7-18(8-10-19)27(34)32-24-15-22(30)23(16-25(24)33)31-28(35)26(6-2)41(37,38)21-13-11-20(40-4)12-14-21/h7-17,26,33H,5-6H2,1-4H3,(H,31,35)(H,32,34) |
| InChIKey | BRSYEUYDXZSRCL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.16 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|