C32H37Cl3N2O6S — CID 59940425
3,4-dichloro-N-[5-chloro-2-hydroxy-4-[2-[4-(2-methyloctoxy)phenyl]sulfonylbutanoylamino]phenyl]benzamide (PubChem CID 59940425) has the molecular formula C32H37Cl3N2O6S and a molecular weight of 684.08 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[2-[4-(2-methyloctoxy)phenyl]sulfonylbutanoylamino]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[2-[4-(2-methyloctoxy)phenyl]sulfonylbutanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 59940425 |
| Molecular Formula | C32H37Cl3N2O6S |
| Molecular Weight | 684.08 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[2-[4-(2-methyloctoxy)phenyl]sulfonylbutanoylamino]phenyl]benzamide |
| SMILES | CCCCCCC(C)COc1ccc(S(=O)(=O)C(CC)C(=O)Nc2cc(O)c(NC(=O)c3ccc(Cl)c(Cl)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C32H37Cl3N2O6S/c1-4-6-7-8-9-20(3)19-43-22-11-13-23(14-12-22)44(41,42)30(5-2)32(40)36-27-18-29(38)28(17-26(27)35)37-31(39)21-10-15-24(33)25(34)16-21/h10-18,20,30,38H,4-9,19H2,1-3H3,(H,36,40)(H,37,39) |
| InChIKey | BSCKYOZVFNMDGI-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.08 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|