C37H43Cl3N2O5 — CID 59940438
3,4-dichloro-N-[5-chloro-2-hydroxy-4-[[2-[4-(2-methyldecoxy)benzoyl]cyclopentanecarbonyl]amino]phenyl]benzamide (PubChem CID 59940438) has the molecular formula C37H43Cl3N2O5 and a molecular weight of 702.12 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[[2-[4-(2-methyldecoxy)benzoyl]cyclopentanecarbonyl]amino]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[[2-[4-(2-methyldecoxy)benzoyl]cyclopentanecarbonyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 59940438 |
| Molecular Formula | C37H43Cl3N2O5 |
| Molecular Weight | 702.12 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-hydroxy-4-[[2-[4-(2-methyldecoxy)benzoyl]cyclopentanecarbonyl]amino]phenyl]benzamide |
| SMILES | CCCCCCCCC(C)COc1ccc(C(=O)C2CCCC2C(=O)Nc2cc(O)c(NC(=O)c3ccc(Cl)c(Cl)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C37H43Cl3N2O5/c1-3-4-5-6-7-8-10-23(2)22-47-26-16-13-24(14-17-26)35(44)27-11-9-12-28(27)37(46)41-32-21-34(43)33(20-31(32)40)42-36(45)25-15-18-29(38)30(39)19-25/h13-21,23,27-28,43H,3-12,22H2,1-2H3,(H,41,46)(H,42,45) |
| InChIKey | HTIWSEWAHPANTE-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.12 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|