C22H24Cl2N2O3 — CID 118877989
4-butoxy-3-(cyclobutanecarbonylamino)-N-(3,4-dichlorophenyl)benzamide (PubChem CID 118877989) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is 4-butoxy-3-(cyclobutanecarbonylamino)-N-(3,4-dichlorophenyl)benzamide.
| Compound Name | 4-butoxy-3-(cyclobutanecarbonylamino)-N-(3,4-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 118877989 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 4-butoxy-3-(cyclobutanecarbonylamino)-N-(3,4-dichlorophenyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)cc1NC(=O)C1CCC1 |
| InChI | InChI=1S/C22H24Cl2N2O3/c1-2-3-11-29-20-10-7-15(12-19(20)26-21(27)14-5-4-6-14)22(28)25-16-8-9-17(23)18(24)13-16/h7-10,12-14H,2-6,11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | LKDBFCKIDQNQCK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|