C17H15Cl4NO2 — CID 18848325
4-butoxy-3,5-dichloro-N-(3,4-dichlorophenyl)benzamide (PubChem CID 18848325) has the molecular formula C17H15Cl4NO2 and a molecular weight of 407.12 g/mol. Its IUPAC name is 4-butoxy-3,5-dichloro-N-(3,4-dichlorophenyl)benzamide.
| Compound Name | 4-butoxy-3,5-dichloro-N-(3,4-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 18848325 |
| Molecular Formula | C17H15Cl4NO2 |
| Molecular Weight | 407.12 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 4-butoxy-3,5-dichloro-N-(3,4-dichlorophenyl)benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C17H15Cl4NO2/c1-2-3-6-24-16-14(20)7-10(8-15(16)21)17(23)22-11-4-5-12(18)13(19)9-11/h4-5,7-9H,2-3,6H2,1H3,(H,22,23) |
| InChIKey | GOUOVEREDSFLRX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.12 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|