C18H20Cl2N2O4S — CID 18848400
3,5-dichloro-4-pentoxy-N-(4-sulfamoylphenyl)benzamide (PubChem CID 18848400) has the molecular formula C18H20Cl2N2O4S and a molecular weight of 431.34 g/mol. Its IUPAC name is 3,5-dichloro-4-pentoxy-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 3,5-dichloro-4-pentoxy-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 18848400 |
| Molecular Formula | C18H20Cl2N2O4S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3,5-dichloro-4-pentoxy-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O4S/c1-2-3-4-9-26-17-15(19)10-12(11-16(17)20)18(23)22-13-5-7-14(8-6-13)27(21,24)25/h5-8,10-11H,2-4,9H2,1H3,(H,22,23)(H2,21,24,25) |
| InChIKey | SRXGUSBZVGPIDQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|