C28H36Cl2N2O4S — CID 18848670
3,5-dichloro-N-[4-(dicyclohexylsulfamoyl)phenyl]-4-propoxybenzamide (PubChem CID 18848670) has the molecular formula C28H36Cl2N2O4S and a molecular weight of 567.58 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(dicyclohexylsulfamoyl)phenyl]-4-propoxybenzamide.
| Compound Name | 3,5-dichloro-N-[4-(dicyclohexylsulfamoyl)phenyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 18848670 |
| Molecular Formula | C28H36Cl2N2O4S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 3,5-dichloro-N-[4-(dicyclohexylsulfamoyl)phenyl]-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2ccc(S(=O)(=O)N(C3CCCCC3)C3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C28H36Cl2N2O4S/c1-2-17-36-27-25(29)18-20(19-26(27)30)28(33)31-21-13-15-24(16-14-21)37(34,35)32(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h13-16,18-19,22-23H,2-12,17H2,1H3,(H,31,33) |
| InChIKey | AXWWXELYLFKXCU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |