C24H30Cl2N2O4S — CID 18848821
3,5-dichloro-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-4-pentoxybenzamide (PubChem CID 18848821) has the molecular formula C24H30Cl2N2O4S and a molecular weight of 513.49 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-4-pentoxybenzamide.
| Compound Name | 3,5-dichloro-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 18848821 |
| Molecular Formula | C24H30Cl2N2O4S |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 3,5-dichloro-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)Nc2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C24H30Cl2N2O4S/c1-3-4-5-14-32-23-21(25)15-18(16-22(23)26)24(29)27-19-6-8-20(9-7-19)33(30,31)28-12-10-17(2)11-13-28/h6-9,15-17H,3-5,10-14H2,1-2H3,(H,27,29) |
| InChIKey | BHPNZCNMCALLTD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|