C20H22Cl3NO2 — CID 18848534
3,5-dichloro-N-(4-chlorophenyl)-4-heptoxybenzamide (PubChem CID 18848534) has the molecular formula C20H22Cl3NO2 and a molecular weight of 414.76 g/mol. Its IUPAC name is 3,5-dichloro-N-(4-chlorophenyl)-4-heptoxybenzamide.
| Compound Name | 3,5-dichloro-N-(4-chlorophenyl)-4-heptoxybenzamide |
|---|---|
| PubChem CID | 18848534 |
| Molecular Formula | C20H22Cl3NO2 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3,5-dichloro-N-(4-chlorophenyl)-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)Nc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C20H22Cl3NO2/c1-2-3-4-5-6-11-26-19-17(22)12-14(13-18(19)23)20(25)24-16-9-7-15(21)8-10-16/h7-10,12-13H,2-6,11H2,1H3,(H,24,25) |
| InChIKey | WYBFJFBIZHIEQI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|