C20H21Cl2NO4 — CID 18848348
ethyl 4-[(4-butoxy-3,5-dichlorobenzoyl)amino]benzoate (PubChem CID 18848348) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is ethyl 4-[(4-butoxy-3,5-dichlorobenzoyl)amino]benzoate.
| Compound Name | ethyl 4-[(4-butoxy-3,5-dichlorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 18848348 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | ethyl 4-[(4-butoxy-3,5-dichlorobenzoyl)amino]benzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2ccc(C(=O)OCC)cc2)cc1Cl |
| InChI | InChI=1S/C20H21Cl2NO4/c1-3-5-10-27-18-16(21)11-14(12-17(18)22)19(24)23-15-8-6-13(7-9-15)20(25)26-4-2/h6-9,11-12H,3-5,10H2,1-2H3,(H,23,24) |
| InChIKey | JGLVTYRNOBAUCC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|