C16H12Cl2NO4- — CID 7412426
4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoate (PubChem CID 7412426) has the molecular formula C16H12Cl2NO4- and a molecular weight of 353.18 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoate.
| Compound Name | 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7412426 |
| Molecular Formula | C16H12Cl2NO4- |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 4-[(3,5-dichloro-4-ethoxybenzoyl)amino]benzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2ccc(C(=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NO4/c1-2-23-14-12(17)7-10(8-13(14)18)15(20)19-11-5-3-9(4-6-11)16(21)22/h3-8H,2H2,1H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | ZKPSTNOENWFZGP-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |