C20H23Cl2NO4S — CID 18848768
ethyl 2-[(4-butoxy-3,5-dichlorobenzoyl)amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 18848768) has the molecular formula C20H23Cl2NO4S and a molecular weight of 444.38 g/mol. Its IUPAC name is ethyl 2-[(4-butoxy-3,5-dichlorobenzoyl)amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-butoxy-3,5-dichlorobenzoyl)amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18848768 |
| Molecular Formula | C20H23Cl2NO4S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | ethyl 2-[(4-butoxy-3,5-dichlorobenzoyl)amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2sc(C)c(C)c2C(=O)OCC)cc1Cl |
| InChI | InChI=1S/C20H23Cl2NO4S/c1-5-7-8-27-17-14(21)9-13(10-15(17)22)18(24)23-19-16(20(25)26-6-2)11(3)12(4)28-19/h9-10H,5-8H2,1-4H3,(H,23,24) |
| InChIKey | CYWKUUVWRUVKOE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|