C23H28Cl2N2O3S — CID 18848966
2-[(3,5-dichloro-4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 18848966) has the molecular formula C23H28Cl2N2O3S and a molecular weight of 483.46 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(3,5-dichloro-4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 18848966 |
| Molecular Formula | C23H28Cl2N2O3S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[(3,5-dichloro-4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)Nc2sc3c(c2C(N)=O)CCCC3)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O3S/c1-2-3-4-5-8-11-30-20-16(24)12-14(13-17(20)25)22(29)27-23-19(21(26)28)15-9-6-7-10-18(15)31-23/h12-13H,2-11H2,1H3,(H2,26,28)(H,27,29) |
| InChIKey | DGXWGLGIBUPOOB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|