C26H27Cl2N3O3S — CID 18848843
2-[(3,5-dichloro-4-pentoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 18848843) has the molecular formula C26H27Cl2N3O3S and a molecular weight of 532.49 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-pentoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(3,5-dichloro-4-pentoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18848843 |
| Molecular Formula | C26H27Cl2N3O3S |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-[(3,5-dichloro-4-pentoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)Nc2sc3c(c2C(=O)NCc2cccnc2)CCC3)cc1Cl |
| InChI | InChI=1S/C26H27Cl2N3O3S/c1-2-3-4-11-34-23-19(27)12-17(13-20(23)28)24(32)31-26-22(18-8-5-9-21(18)35-26)25(33)30-15-16-7-6-10-29-14-16/h6-7,10,12-14H,2-5,8-9,11,15H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | IAGXAFCPDPTEQS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|