C27H29Cl2N3O3S — CID 18848924
2-[(3,5-dichloro-4-hexoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 18848924) has the molecular formula C27H29Cl2N3O3S and a molecular weight of 546.52 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-hexoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(3,5-dichloro-4-hexoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18848924 |
| Molecular Formula | C27H29Cl2N3O3S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 2-[(3,5-dichloro-4-hexoxybenzoyl)amino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)Nc2sc3c(c2C(=O)NCc2cccnc2)CCC3)cc1Cl |
| InChI | InChI=1S/C27H29Cl2N3O3S/c1-2-3-4-5-12-35-24-20(28)13-18(14-21(24)29)25(33)32-27-23(19-9-6-10-22(19)36-27)26(34)31-16-17-8-7-11-30-15-17/h7-8,11,13-15H,2-6,9-10,12,16H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | SVKUZFUMQXMNKJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|