C20H24Cl2N2O2 — CID 18848579
3,5-dichloro-4-heptoxy-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 18848579) has the molecular formula C20H24Cl2N2O2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 3,5-dichloro-4-heptoxy-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 3,5-dichloro-4-heptoxy-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18848579 |
| Molecular Formula | C20H24Cl2N2O2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3,5-dichloro-4-heptoxy-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)NCc2ccncc2)cc1Cl |
| InChI | InChI=1S/C20H24Cl2N2O2/c1-2-3-4-5-6-11-26-19-17(21)12-16(13-18(19)22)20(25)24-14-15-7-9-23-10-8-15/h7-10,12-13H,2-6,11,14H2,1H3,(H,24,25) |
| InChIKey | QEIJWFLUMOATPU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|