C20H22Cl2N2O4 — CID 18848538
3,5-dichloro-4-heptoxy-N-(3-nitrophenyl)benzamide (PubChem CID 18848538) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is 3,5-dichloro-4-heptoxy-N-(3-nitrophenyl)benzamide.
| Compound Name | 3,5-dichloro-4-heptoxy-N-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 18848538 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3,5-dichloro-4-heptoxy-N-(3-nitrophenyl)benzamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)Nc2cccc([N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-2-3-4-5-6-10-28-19-17(21)11-14(12-18(19)22)20(25)23-15-8-7-9-16(13-15)24(26)27/h7-9,11-13H,2-6,10H2,1H3,(H,23,25) |
| InChIKey | VSMNMQUGFIGTMR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|