C18H19Cl2N3O2S — CID 87564001
N-[(4-aminophenyl)carbamothioyl]-4-butoxy-3,5-dichlorobenzamide (PubChem CID 87564001) has the molecular formula C18H19Cl2N3O2S and a molecular weight of 412.34 g/mol. Its IUPAC name is N-[(4-aminophenyl)carbamothioyl]-4-butoxy-3,5-dichlorobenzamide.
| Compound Name | N-[(4-aminophenyl)carbamothioyl]-4-butoxy-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 87564001 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[(4-aminophenyl)carbamothioyl]-4-butoxy-3,5-dichlorobenzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(N)cc2)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O2S/c1-2-3-8-25-16-14(19)9-11(10-15(16)20)17(24)23-18(26)22-13-6-4-12(21)5-7-13/h4-7,9-10H,2-3,8,21H2,1H3,(H2,22,23,24,26) |
| InChIKey | HSAHVLXLEQFBRK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|