C19H24Cl2N2O4 — CID 119420177
N-(3-amino-4-methoxyphenyl)-4-butoxy-3-chloro-5-methoxybenzamide;hydrochloride (PubChem CID 119420177) has the molecular formula C19H24Cl2N2O4 and a molecular weight of 415.32 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-4-butoxy-3-chloro-5-methoxybenzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-4-butoxy-3-chloro-5-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119420177 |
| Molecular Formula | C19H24Cl2N2O4 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-4-butoxy-3-chloro-5-methoxybenzamide;hydrochloride |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2ccc(OC)c(N)c2)cc1OC.Cl |
| InChI | InChI=1S/C19H23ClN2O4.ClH/c1-4-5-8-26-18-14(20)9-12(10-17(18)25-3)19(23)22-13-6-7-16(24-2)15(21)11-13;/h6-7,9-11H,4-5,8,21H2,1-3H3,(H,22,23);1H |
| InChIKey | RTYVVWRNAGHYJM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|