C22H27ClN2O5 — CID 33309669
N-(3-acetamido-4-methoxyphenyl)-4-butoxy-3-chloro-5-ethoxybenzamide (PubChem CID 33309669) has the molecular formula C22H27ClN2O5 and a molecular weight of 434.92 g/mol. Its IUPAC name is N-(3-acetamido-4-methoxyphenyl)-4-butoxy-3-chloro-5-ethoxybenzamide.
| Compound Name | N-(3-acetamido-4-methoxyphenyl)-4-butoxy-3-chloro-5-ethoxybenzamide |
|---|---|
| PubChem CID | 33309669 |
| Molecular Formula | C22H27ClN2O5 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-(3-acetamido-4-methoxyphenyl)-4-butoxy-3-chloro-5-ethoxybenzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2ccc(OC)c(NC(C)=O)c2)cc1OCC |
| InChI | InChI=1S/C22H27ClN2O5/c1-5-7-10-30-21-17(23)11-15(12-20(21)29-6-2)22(27)25-16-8-9-19(28-4)18(13-16)24-14(3)26/h8-9,11-13H,5-7,10H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | QORRTDCRSNPUSZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|