C22H29ClN2O6S — CID 55948208
4-butoxy-3-chloro-5-ethoxy-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]benzamide (PubChem CID 55948208) has the molecular formula C22H29ClN2O6S and a molecular weight of 485.00 g/mol. Its IUPAC name is 4-butoxy-3-chloro-5-ethoxy-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]benzamide.
| Compound Name | 4-butoxy-3-chloro-5-ethoxy-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 55948208 |
| Molecular Formula | C22H29ClN2O6S |
| Molecular Weight | 485.00 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-butoxy-3-chloro-5-ethoxy-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2ccc(NS(=O)(=O)CC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C22H29ClN2O6S/c1-5-8-11-31-21-17(23)12-15(13-20(21)30-6-2)22(26)24-16-9-10-18(19(14-16)29-4)25-32(27,28)7-3/h9-10,12-14,25H,5-8,11H2,1-4H3,(H,24,26) |
| InChIKey | LEVSJAQAWILUQK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.00 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|