C18H21BrN2O6S — CID 55956522
4-bromo-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-3,5-dimethoxybenzamide (PubChem CID 55956522) has the molecular formula C18H21BrN2O6S and a molecular weight of 473.35 g/mol. Its IUPAC name is 4-bromo-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 55956522 |
| Molecular Formula | C18H21BrN2O6S |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 4-bromo-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-3,5-dimethoxybenzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)c2cc(OC)c(Br)c(OC)c2)cc1OC |
| InChI | InChI=1S/C18H21BrN2O6S/c1-5-28(23,24)21-13-7-6-12(10-14(13)25-2)20-18(22)11-8-15(26-3)17(19)16(9-11)27-4/h6-10,21H,5H2,1-4H3,(H,20,22) |
| InChIKey | RTUSLLYJIXOSLW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |