C14H24ClN3O5S — CID 119739356
N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119739356) has the molecular formula C14H24ClN3O5S and a molecular weight of 381.88 g/mol. Its IUPAC name is N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119739356 |
| Molecular Formula | C14H24ClN3O5S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)CNCCOC)cc1OC.Cl |
| InChI | InChI=1S/C14H23N3O5S.ClH/c1-4-23(19,20)17-12-6-5-11(9-13(12)22-3)16-14(18)10-15-7-8-21-2;/h5-6,9,15,17H,4,7-8,10H2,1-3H3,(H,16,18);1H |
| InChIKey | QKSNHYHMCLYIKQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|