C17H28ClN3O5S — CID 119677471
2-(2-methoxyethylamino)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)acetamide;hydrochloride (PubChem CID 119677471) has the molecular formula C17H28ClN3O5S and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119677471 |
| Molecular Formula | C17H28ClN3O5S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(OC)c(S(=O)(=O)N2CCCCC2)c1.Cl |
| InChI | InChI=1S/C17H27N3O5S.ClH/c1-24-11-8-18-13-17(21)19-14-6-7-15(25-2)16(12-14)26(22,23)20-9-4-3-5-10-20;/h6-7,12,18H,3-5,8-11,13H2,1-2H3,(H,19,21);1H |
| InChIKey | JFEKCXWMEWATPZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|